Hydroxypropyl-beta-Cyclodextrin - 128446-35-5 Specificaton & Trade Terms
Model | 128446-35-5 |
---|
Place Of Origin | China |
---|
Price Term | EX-Work |
---|
Payment Term | T/T |
---|
Hydroxypropyl-beta-Cyclodextrin
Other name: HP-β-CD
1.Appearance: Hydroxypropyl-beta-Cyclodextrin is white powder, sweet, insipid innocent and can be used in both medicine field and food field.
2.Molecular formula: C42H70-XO35(CH2CHOH-CH3)X ;
3.Molecular weght:1135+58X;
4.CAS No.:128446-35-5 ;
5.Spec: 99%;
6.Store: Cool and dry, avoid light, avoid high temperature place;
7.Packaging:1kg/bag 10kg/barrel,or customized.
Application in different fields:
Pharmaceutical:
1. To increase the solubility of medicine and biological availability
2. To improve the bioavailability of drugs
3. To adjust or control the releasing of drugs.
4. To decrease the toxicities of drugs.
5. To improve the stabilities of drugs.
Cosmetic:
1. To suit for encapsulation of volatile compounds.
2. To increase shelf life of expensive flavours.
Food:
1.To prevent evaporation of volatile substances.
2.To get rid of the terrible smell.
3.To significantly enhance the effects of emulsification.
4.To make preservative of food release slowly.